C17H28O2P+ — CID 89284186
ethoxy-oxo-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium (PubChem CID 89284186) has the molecular formula C17H28O2P+ and a molecular weight of 295.38 g/mol. Its IUPAC name is ethoxy-oxo-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium.
| Compound Name | ethoxy-oxo-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium |
|---|---|
| PubChem CID | 89284186 |
| Molecular Formula | C17H28O2P+ |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethoxy-oxo-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium |
| SMILES | CCO[P+](=O)C/C=C(C)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H28O2P/c1-6-19-20(18)14-13-17(5)12-8-11-16(4)10-7-9-15(2)3/h8-9,11-13H,6-7,10,14H2,1-5H3/q+1/b12-8+,16-11+,17-13+ |
| InChIKey | XBOKQGMCRBIXPC-NPGZCLSRSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|