About 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane
3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane (PubChem CID 89284204) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane |
| PubChem CID | 89284204 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane |
| SMILES | C=CC1CCC2(C1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C12H20O2/c1-4-10-5-6-12(7-10)13-8-11(2,3)9-14-12/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | JAFSAKFVTWDYOF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane?
The IUPAC name of 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane (CID 89284204) is 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane.
What is the SMILES notation for 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane?
The canonical SMILES for 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane is C=CC1CCC2(C1)OCC(C)(C)CO2.
What is the InChIKey of 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane?
The InChIKey is JAFSAKFVTWDYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-4-10-5-6-12(7-10)13-8-11(2,3)9-14-12/h4,10H,1,5-9H2,2-3H3.
What are the key properties of 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane?
3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane has a molecular weight of 196.29 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-8,8-dimethyl-6,10-dioxaspiro[4.5]decane is sourced from PubChem (CID 89284204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).