C6H13NS — CID 89284281
2,4,5-trimethyl-1,3-thiazolidine (PubChem CID 89284281) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-thiazolidine.
| Compound Name | 2,4,5-trimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 89284281 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 2,4,5-trimethyl-1,3-thiazolidine |
| SMILES | CC1NC(C)C(C)S1 |
| InChI | InChI=1S/C6H13NS/c1-4-5(2)8-6(3)7-4/h4-7H,1-3H3 |
| InChIKey | WVBKHRXICZEHEK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |