C13H17N3O3 — CID 89284345
1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 89284345) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89284345 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCC(CC=C)(C(=C)C)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17N3O3/c1-5-7-13(8-6-2,9(3)4)16-11(18)14-10(17)15-12(16)19/h5-6H,1-3,7-8H2,4H3,(H2,14,15,17,18,19) |
| InChIKey | MTDOKTUPDOQQHV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|