C27H27Cl2F6N5O — CID 89284750
N-[[4-chloro-3-[[9-chloro-5-methyl-8-[4-(trifluoromethyl)piperidin-1-yl]-3,5-diazatricyclo[6.1.1.02,6]deca-1,3,6-trien-4-yl]amino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 89284750) has the molecular formula C27H27Cl2F6N5O and a molecular weight of 622.44 g/mol. Its IUPAC name is N-[[4-chloro-3-[[9-chloro-5-methyl-8-[4-(trifluoromethyl)piperidin-1-yl]-3,5-diazatricyclo[6.1.1.02,6]deca-1,3,6-trien-4-yl]amino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[[4-chloro-3-[[9-chloro-5-methyl-8-[4-(trifluoromethyl)piperidin-1-yl]-3,5-diazatricyclo[6.1.1.02,6]deca-1,3,6-trien-4-yl]amino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89284750 |
| Molecular Formula | C27H27Cl2F6N5O |
| Molecular Weight | 622.44 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | N-[[4-chloro-3-[[9-chloro-5-methyl-8-[4-(trifluoromethyl)piperidin-1-yl]-3,5-diazatricyclo[6.1.1.02,6]deca-1,3,6-trien-4-yl]amino]phenyl]methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | Cn1c(Nc2cc(CNC(=O)C3(C(F)(F)F)CC3)ccc2Cl)nc2c1=CC1(N3CCC(C(F)(F)F)CC3)CC=2C1Cl |
| InChI | InChI=1S/C27H27Cl2F6N5O/c1-39-19-12-25(40-8-4-15(5-9-40)26(30,31)32)11-16(21(25)29)20(19)38-23(39)37-18-10-14(2-3-17(18)28)13-36-22(41)24(6-7-24)27(33,34)35/h2-3,10,12,15,21H,4-9,11,13H2,1H3,(H,36,41)(H,37,38) |
| InChIKey | HHNMTPFPDFXIAJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|