C39H31F3N2O7 — CID 89284796
2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-phenylbenzoyl)oxyphenyl]methyl]amino]acetic acid (PubChem CID 89284796) has the molecular formula C39H31F3N2O7 and a molecular weight of 696.68 g/mol. Its IUPAC name is 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-phenylbenzoyl)oxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-phenylbenzoyl)oxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284796 |
| Molecular Formula | C39H31F3N2O7 |
| Molecular Weight | 696.68 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-phenylbenzoyl)oxyphenyl]methyl]amino]acetic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)N(CC(=O)O)Cc3ccc(OC(=O)c4ccc(-c5ccccc5)cc4)cc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H31F3N2O7/c1-50-33-20-15-30(34(22-33)39(40,41)42)21-35(45)43-31-16-13-28(14-17-31)37(48)44(24-36(46)47)23-25-7-18-32(19-8-25)51-38(49)29-11-9-27(10-12-29)26-5-3-2-4-6-26/h2-20,22H,21,23-24H2,1H3,(H,43,45)(H,46,47) |
| InChIKey | VFVDRFRDNWYTAS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|