About 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide
2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide (PubChem CID 89285513) has the molecular formula C9H12FNO
and a molecular weight of 169.20 g/mol. Its IUPAC name is 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide |
| PubChem CID | 89285513 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)CC1C=CC(F)=CC1 |
| InChI | InChI=1S/C9H12FNO/c1-11-9(12)6-7-2-4-8(10)5-3-7/h2,4-5,7H,3,6H2,1H3,(H,11,12) |
| InChIKey | VSIODNSUXYSFJL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide?
The IUPAC name of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide (CID 89285513) is 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide.
What is the SMILES notation for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide?
The canonical SMILES for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide is CNC(=O)CC1C=CC(F)=CC1.
What is the InChIKey of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide?
The InChIKey is VSIODNSUXYSFJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO/c1-11-9(12)6-7-2-4-8(10)5-3-7/h2,4-5,7H,3,6H2,1H3,(H,11,12).
What are the key properties of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide?
2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide has a molecular weight of 169.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylacetamide is sourced from PubChem (CID 89285513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).