C16H20N2O2 — CID 89285704
(1E,3Z)-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-triene-1,2-diamine (PubChem CID 89285704) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (1E,3Z)-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1E,3Z)-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 89285704 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (1E,3Z)-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C(/C=C\C(N)=C/N)Oc1ccc2c(c1)C(C)(C)OC2 |
| InChI | InChI=1S/C16H20N2O2/c1-11(4-6-13(18)9-17)20-14-7-5-12-10-19-16(2,3)15(12)8-14/h4-9H,1,10,17-18H2,2-3H3/b6-4-,13-9+ |
| InChIKey | LMKCJAFSDINPOZ-WZSXDBPKSA-N |
| XLogP | 2.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|