C12H16FN3O2 — CID 89285736
(5R)-3-[(1E,3Z)-1-amino-5-fluorohexa-1,3,5-trien-2-yl]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 89285736) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is (5R)-3-[(1E,3Z)-1-amino-5-fluorohexa-1,3,5-trien-2-yl]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(1E,3Z)-1-amino-5-fluorohexa-1,3,5-trien-2-yl]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89285736 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (5R)-3-[(1E,3Z)-1-amino-5-fluorohexa-1,3,5-trien-2-yl]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | C=C(F)/C=C\C(=C/N)N1C(=O)N[C@](C)(CC)C1=O |
| InChI | InChI=1S/C12H16FN3O2/c1-4-12(3)10(17)16(11(18)15-12)9(7-14)6-5-8(2)13/h5-7H,2,4,14H2,1,3H3,(H,15,18)/b6-5-,9-7+/t12-/m1/s1 |
| InChIKey | YDFIJYCPZSKOHY-DITYGTJMSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|