C15H27NO — CID 89285810
3,5,5-trimethyl-N,N-bis(prop-2-enyl)hexanamide (PubChem CID 89285810) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 3,5,5-trimethyl-N,N-bis(prop-2-enyl)hexanamide.
| Compound Name | 3,5,5-trimethyl-N,N-bis(prop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 89285810 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 3,5,5-trimethyl-N,N-bis(prop-2-enyl)hexanamide |
| SMILES | C=CCN(CC=C)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-7-9-16(10-8-2)14(17)11-13(3)12-15(4,5)6/h7-8,13H,1-2,9-12H2,3-6H3 |
| InChIKey | WZUGQRFRUXUEKH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|