C20H16Cl2F3NO — CID 89286093
1-[4-[(3R)-3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]ethenol (PubChem CID 89286093) has the molecular formula C20H16Cl2F3NO and a molecular weight of 414.25 g/mol. Its IUPAC name is 1-[4-[(3R)-3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]ethenol.
| Compound Name | 1-[4-[(3R)-3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]ethenol |
|---|---|
| PubChem CID | 89286093 |
| Molecular Formula | C20H16Cl2F3NO |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 1-[4-[(3R)-3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]ethenol |
| SMILES | C=C(O)c1ccc(C2=NC[C@@](c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C20H16Cl2F3NO/c1-11-5-13(3-4-17(11)12(2)27)18-9-19(10-26-18,20(23,24)25)14-6-15(21)8-16(22)7-14/h3-8,27H,2,9-10H2,1H3/t19-/m0/s1 |
| InChIKey | JTDJBYFZFCANPC-IBGZPJMESA-N |
| XLogP | 6.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|