C59H33N9O3 — CID 89286105
6,7,17-tris(1-phenylbenzimidazol-2-yl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 89286105) has the molecular formula C59H33N9O3 and a molecular weight of 915.97 g/mol. Its IUPAC name is 6,7,17-tris(1-phenylbenzimidazol-2-yl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 6,7,17-tris(1-phenylbenzimidazol-2-yl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 89286105 |
| Molecular Formula | C59H33N9O3 |
| Molecular Weight | 915.97 g/mol |
| Exact Mass | 915.27 |
| IUPAC Name | 6,7,17-tris(1-phenylbenzimidazol-2-yl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5cc(-c6nc7ccccc7n6-c6ccccc6)c(-c6nc7ccccc7n6-c6ccccc6)cc5nc4c4ccc(c2c34)C(=O)N1c1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C59H33N9O3/c69-56-38-30-31-40-52-39(57(70)68(58(40)71)59-63-45-24-12-15-27-49(45)66(59)36-20-8-3-9-21-36)29-28-37(51(38)52)53-62-46-32-41(54-60-43-22-10-13-25-47(43)64(54)34-16-4-1-5-17-34)42(33-50(46)67(53)56)55-61-44-23-11-14-26-48(44)65(55)35-18-6-2-7-19-35/h1-33H |
| InChIKey | VGHCPNBHVKUCQQ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 125.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.97 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|