About 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol
4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol (PubChem CID 89286116) has the molecular formula C12H9Cl2FO2
and a molecular weight of 275.11 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol.
Molecular Properties
| Compound Name | 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol |
| PubChem CID | 89286116 |
| Molecular Formula | C12H9Cl2FO2 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol |
| SMILES | C=C(F)C(O)(C#CCO)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2FO2/c1-8(15)12(17,3-2-4-16)9-5-10(13)7-11(14)6-9/h5-7,16-17H,1,4H2 |
| InChIKey | MCHGRPZLQZWGNY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol?
The IUPAC name of 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol (CID 89286116) is 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol.
What is the SMILES notation for 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol?
The canonical SMILES for 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol is C=C(F)C(O)(C#CCO)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol?
The InChIKey is MCHGRPZLQZWGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2FO2/c1-8(15)12(17,3-2-4-16)9-5-10(13)7-11(14)6-9/h5-7,16-17H,1,4H2.
What are the key properties of 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol?
4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol has a molecular weight of 275.11 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichlorophenyl)-5-fluorohex-5-en-2-yne-1,4-diol is sourced from PubChem (CID 89286116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).