C24H7F6N5O3S — CID 89286279
17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 89286279) has the molecular formula C24H7F6N5O3S and a molecular weight of 559.41 g/mol. Its IUPAC name is 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 89286279 |
| Molecular Formula | C24H7F6N5O3S |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5nc(C(F)(F)F)c(C(F)(F)F)nc5nc4c4ccc(c2c34)C(=O)N1c1cccs1 |
| InChI | InChI=1S/C24H7F6N5O3S/c25-23(26,27)15-16(24(28,29)30)32-19-17(31-15)33-18-8-3-4-10-14-11(6-5-9(13(8)14)22(38)35(18)19)21(37)34(20(10)36)12-2-1-7-39-12/h1-7H |
| InChIKey | IVKAYYILMOIPBI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 97.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|