C26H9F6N3O3S — CID 89286280
17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 89286280) has the molecular formula C26H9F6N3O3S and a molecular weight of 557.43 g/mol. Its IUPAC name is 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 89286280 |
| Molecular Formula | C26H9F6N3O3S |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 557.03 |
| IUPAC Name | 17-thiophen-2-yl-6,7-bis(trifluoromethyl)-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5cc(C(F)(F)F)c(C(F)(F)F)cc5nc4c4ccc(c2c34)C(=O)N1c1cccs1 |
| InChI | InChI=1S/C26H9F6N3O3S/c27-25(28,29)14-8-16-17(9-15(14)26(30,31)32)34-21(33-16)10-3-4-12-20-13(6-5-11(19(10)20)22(34)36)24(38)35(23(12)37)18-2-1-7-39-18/h1-9H |
| InChIKey | OZSTZLFUBZCIPA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|