C8H12O3 — CID 89286343
(3aR,6R)-2-methyl-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol (PubChem CID 89286343) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3aR,6R)-2-methyl-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol.
| Compound Name | (3aR,6R)-2-methyl-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol |
|---|---|
| PubChem CID | 89286343 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (3aR,6R)-2-methyl-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol |
| SMILES | CC1C[C@@]2(O)C=C[C@@H](O)C2O1 |
| InChI | InChI=1S/C8H12O3/c1-5-4-8(10)3-2-6(9)7(8)11-5/h2-3,5-7,9-10H,4H2,1H3/t5?,6-,7?,8+/m1/s1 |
| InChIKey | XYEDSNIEZPXCIR-ZPFXWGDGSA-N |
| XLogP | -0.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|