C18H17ClF3N3O5S — CID 89286374
1-[(4aR,7aR)-6-[(6-chloro-2-prop-1-en-2-yl-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone (PubChem CID 89286374) has the molecular formula C18H17ClF3N3O5S and a molecular weight of 479.86 g/mol. Its IUPAC name is 1-[(4aR,7aR)-6-[(6-chloro-2-prop-1-en-2-yl-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aR,7aR)-6-[(6-chloro-2-prop-1-en-2-yl-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 89286374 |
| Molecular Formula | C18H17ClF3N3O5S |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 1-[(4aR,7aR)-6-[(6-chloro-2-prop-1-en-2-yl-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone |
| SMILES | C=C(C)c1nc2ccc(Cl)c(S(=O)(=O)N3C[C@@H]4[C@@H](C3)OCCN4C(=O)C(F)(F)F)c2o1 |
| InChI | InChI=1S/C18H17ClF3N3O5S/c1-9(2)16-23-11-4-3-10(19)15(14(11)30-16)31(27,28)24-7-12-13(8-24)29-6-5-25(12)17(26)18(20,21)22/h3-4,12-13H,1,5-8H2,2H3/t12-,13-/m1/s1 |
| InChIKey | CJEKUJNSXAEUPM-CHWSQXEVSA-N |
| XLogP | 2.68 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |