C8H11FO4 — CID 89286547
(2S,3aR,6S)-5-fluoro-2-methoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol (PubChem CID 89286547) has the molecular formula C8H11FO4 and a molecular weight of 190.17 g/mol. Its IUPAC name is (2S,3aR,6S)-5-fluoro-2-methoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol.
| Compound Name | (2S,3aR,6S)-5-fluoro-2-methoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol |
|---|---|
| PubChem CID | 89286547 |
| Molecular Formula | C8H11FO4 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2S,3aR,6S)-5-fluoro-2-methoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3a,6-diol |
| SMILES | CO[C@@H]1C[C@@]2(O)C=C(F)[C@@H](O)C2O1 |
| InChI | InChI=1S/C8H11FO4/c1-12-5-3-8(11)2-4(9)6(10)7(8)13-5/h2,5-7,10-11H,3H2,1H3/t5-,6+,7?,8-/m0/s1 |
| InChIKey | PKCIKIYRDQBSFZ-WHBCSPCOSA-N |
| XLogP | -0.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |