About 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole
4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole (PubChem CID 89286590) has the molecular formula C8H8ClNS
and a molecular weight of 185.68 g/mol. Its IUPAC name is 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole |
| PubChem CID | 89286590 |
| Molecular Formula | C8H8ClNS |
| Molecular Weight | 185.68 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole |
| SMILES | C=C/C=C(\C)c1nc(Cl)cs1 |
| InChI | InChI=1S/C8H8ClNS/c1-3-4-6(2)8-10-7(9)5-11-8/h3-5H,1H2,2H3/b6-4+ |
| InChIKey | SJVXITZFCLOHGQ-GQCTYLIASA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole?
The IUPAC name of 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole (CID 89286590) is 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole.
What is the SMILES notation for 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole?
The canonical SMILES for 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole is C=C/C=C(\C)c1nc(Cl)cs1.
What is the InChIKey of 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole?
The InChIKey is SJVXITZFCLOHGQ-GQCTYLIASA-N. The full InChI is InChI=1S/C8H8ClNS/c1-3-4-6(2)8-10-7(9)5-11-8/h3-5H,1H2,2H3/b6-4+.
What are the key properties of 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole?
4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole has a molecular weight of 185.68 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(2E)-penta-2,4-dien-2-yl]-1,3-thiazole is sourced from PubChem (CID 89286590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).