C18H19F2NO2S — CID 8928675
N-(2,6-difluorophenyl)-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]acetamide (PubChem CID 8928675) has the molecular formula C18H19F2NO2S and a molecular weight of 351.42 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 8928675 |
| Molecular Formula | C18H19F2NO2S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]acetamide |
| SMILES | Cc1cc(C)cc(OCCSCC(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H19F2NO2S/c1-12-8-13(2)10-14(9-12)23-6-7-24-11-17(22)21-18-15(19)4-3-5-16(18)20/h3-5,8-10H,6-7,11H2,1-2H3,(H,21,22) |
| InChIKey | PZTCQJPONWZFDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|