About 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol
1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol (PubChem CID 89286870) has the molecular formula C12H13BrF2O
and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol.
Molecular Properties
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol |
| PubChem CID | 89286870 |
| Molecular Formula | C12H13BrF2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol |
| SMILES | C=CCC(O)CCc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H13BrF2O/c1-2-3-9(16)5-4-8-6-10(13)12(15)7-11(8)14/h2,6-7,9,16H,1,3-5H2 |
| InChIKey | NIZJGAJSKUANNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol?
The IUPAC name of 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol (CID 89286870) is 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol.
What is the SMILES notation for 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol?
The canonical SMILES for 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol is C=CCC(O)CCc1cc(Br)c(F)cc1F.
What is the InChIKey of 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol?
The InChIKey is NIZJGAJSKUANNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF2O/c1-2-3-9(16)5-4-8-6-10(13)12(15)7-11(8)14/h2,6-7,9,16H,1,3-5H2.
What are the key properties of 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol?
1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol has a molecular weight of 291.14 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2,4-difluorophenyl)hex-5-en-3-ol is sourced from PubChem (CID 89286870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).