C8H13NS — CID 89286887
2,4,4a,5,6,8a-hexahydro-1H-3,1-benzothiazine (PubChem CID 89286887) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2,4,4a,5,6,8a-hexahydro-1H-3,1-benzothiazine.
| Compound Name | 2,4,4a,5,6,8a-hexahydro-1H-3,1-benzothiazine |
|---|---|
| PubChem CID | 89286887 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2,4,4a,5,6,8a-hexahydro-1H-3,1-benzothiazine |
| SMILES | C1=CC2NCSCC2CC1 |
| InChI | InChI=1S/C8H13NS/c1-2-4-8-7(3-1)5-10-6-9-8/h2,4,7-9H,1,3,5-6H2 |
| InChIKey | WZIFNXOSKAZXDR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|