C5F8O3 — CID 89287073
4,4,5-trifluoro-5-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolan-2-one (PubChem CID 89287073) has the molecular formula C5F8O3 and a molecular weight of 260.04 g/mol. Its IUPAC name is 4,4,5-trifluoro-5-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolan-2-one.
| Compound Name | 4,4,5-trifluoro-5-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 89287073 |
| Molecular Formula | C5F8O3 |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 4,4,5-trifluoro-5-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OC(F)(F)C(F)(C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C5F8O3/c6-2(7,4(9,10)11)3(8)5(12,13)16-1(14)15-3 |
| InChIKey | WCSQIKWXGNOCCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|