C21H25ClN2 — CID 89287174
1-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine (PubChem CID 89287174) has the molecular formula C21H25ClN2 and a molecular weight of 345.93 g/mol. Its IUPAC name is 1-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine.
| Compound Name | 1-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 89287174 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 345.93 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H]2C[C@@H](N3CCNC(C)(C)C3)c3cc(Cl)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C21H25ClN2/c1-21(2)14-24(11-10-23-21)20-13-18(15-6-4-3-5-7-15)17-9-8-16(22)12-19(17)20/h3-9,12,18,20,23H,10-11,13-14H2,1-2H3/t18-,20+/m0/s1/i3D,4D,5D,6D,7D |
| InChIKey | FBCSWIXKXHSYBN-LSQWYULJSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |