C29H33F6N5O13S2 — CID 89287193
3-[[4-[[(2S)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]sulfamoyl]phenoxy]methyl]-2-methylindole-1-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 89287193) has the molecular formula C29H33F6N5O13S2 and a molecular weight of 837.73 g/mol. Its IUPAC name is 3-[[4-[[(2S)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]sulfamoyl]phenoxy]methyl]-2-methylindole-1-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[[4-[[(2S)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]sulfamoyl]phenoxy]methyl]-2-methylindole-1-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 89287193 |
| Molecular Formula | C29H33F6N5O13S2 |
| Molecular Weight | 837.73 g/mol |
| Exact Mass | 837.14 |
| IUPAC Name | 3-[[4-[[(2S)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]sulfamoyl]phenoxy]methyl]-2-methylindole-1-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1c(COc2ccc(S(=O)(=O)NC[C@@H](C(=O)NO)N3CCN(S(C)(=O)=O)CC3)cc2)c2ccccc2n1C(=O)O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H31N5O9S2.2C2HF3O2/c1-17-21(20-5-3-4-6-22(20)30(17)25(32)33)16-39-18-7-9-19(10-8-18)41(37,38)26-15-23(24(31)27-34)28-11-13-29(14-12-28)40(2,35)36;2*3-2(4,5)1(6)7/h3-10,23,26,34H,11-16H2,1-2H3,(H,27,31)(H,32,33);2*(H,6,7)/t23-;;/m0../s1 |
| InChIKey | BZWQJCVFAHSHSY-IFUPQEAVSA-N |
| XLogP | 2.05 |
| TPSA | 262.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|