About chloro-oxo-(2,4,6-trimethylphenyl)phosphanium
chloro-oxo-(2,4,6-trimethylphenyl)phosphanium (PubChem CID 89287459) has the molecular formula C9H11ClOP+
and a molecular weight of 201.61 g/mol. Its IUPAC name is chloro-oxo-(2,4,6-trimethylphenyl)phosphanium.
Molecular Properties
| Compound Name | chloro-oxo-(2,4,6-trimethylphenyl)phosphanium |
| PubChem CID | 89287459 |
| Molecular Formula | C9H11ClOP+ |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | chloro-oxo-(2,4,6-trimethylphenyl)phosphanium |
| SMILES | Cc1cc(C)c([P+](=O)Cl)c(C)c1 |
| InChI | InChI=1S/C9H11ClOP/c1-6-4-7(2)9(12(10)11)8(3)5-6/h4-5H,1-3H3/q+1 |
| InChIKey | FWYUJCVPSSMCNW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-oxo-(2,4,6-trimethylphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-oxo-(2,4,6-trimethylphenyl)phosphanium?
The IUPAC name of chloro-oxo-(2,4,6-trimethylphenyl)phosphanium (CID 89287459) is chloro-oxo-(2,4,6-trimethylphenyl)phosphanium.
What is the SMILES notation for chloro-oxo-(2,4,6-trimethylphenyl)phosphanium?
The canonical SMILES for chloro-oxo-(2,4,6-trimethylphenyl)phosphanium is Cc1cc(C)c([P+](=O)Cl)c(C)c1.
What is the InChIKey of chloro-oxo-(2,4,6-trimethylphenyl)phosphanium?
The InChIKey is FWYUJCVPSSMCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClOP/c1-6-4-7(2)9(12(10)11)8(3)5-6/h4-5H,1-3H3/q+1.
What are the key properties of chloro-oxo-(2,4,6-trimethylphenyl)phosphanium?
chloro-oxo-(2,4,6-trimethylphenyl)phosphanium has a molecular weight of 201.61 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-oxo-(2,4,6-trimethylphenyl)phosphanium is sourced from PubChem (CID 89287459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).