C20H34N2 — CID 89287511
2,3-bis(5-methylhexan-2-yl)cyclohexa-2,5-diene-1,4-diimine (PubChem CID 89287511) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 2,3-bis(5-methylhexan-2-yl)cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2,3-bis(5-methylhexan-2-yl)cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 89287511 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 2,3-bis(5-methylhexan-2-yl)cyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(C(C)CCC(C)C)=C1C(C)CCC(C)C |
| InChI | InChI=1S/C20H34N2/c1-13(2)7-9-15(5)19-17(21)11-12-18(22)20(19)16(6)10-8-14(3)4/h11-16,21-22H,7-10H2,1-6H3/b21-17+,22-18+ |
| InChIKey | MTFZHAITVQAKHK-KSTNYAOJSA-N |
| XLogP | 6.04 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|