C8H7F9O5 — CID 89287670
1-ethoxy-2,2,2-trifluoroethanol;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 89287670) has the molecular formula C8H7F9O5 and a molecular weight of 354.12 g/mol. Its IUPAC name is 1-ethoxy-2,2,2-trifluoroethanol;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 1-ethoxy-2,2,2-trifluoroethanol;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89287670 |
| Molecular Formula | C8H7F9O5 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1-ethoxy-2,2,2-trifluoroethanol;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | CCOC(O)C(F)(F)F.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4F6O3.C4H7F3O2/c5-3(6,7)1(11)13-2(12)4(8,9)10;1-2-9-3(8)4(5,6)7/h;3,8H,2H2,1H3 |
| InChIKey | ZMNDTPAWGFXYBD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|