C37H53NO3 — CID 89288854
(E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3,5-dimethylphenyl]pentan-3-yl]-2,4-dimethylcyclohexa-1,5-dien-1-yl]pent-1-en-3-ol (PubChem CID 89288854) has the molecular formula C37H53NO3 and a molecular weight of 559.84 g/mol. Its IUPAC name is (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3,5-dimethylphenyl]pentan-3-yl]-2,4-dimethylcyclohexa-1,5-dien-1-yl]pent-1-en-3-ol.
| Compound Name | (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3,5-dimethylphenyl]pentan-3-yl]-2,4-dimethylcyclohexa-1,5-dien-1-yl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 89288854 |
| Molecular Formula | C37H53NO3 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.40 |
| IUPAC Name | (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3,5-dimethylphenyl]pentan-3-yl]-2,4-dimethylcyclohexa-1,5-dien-1-yl]pent-1-en-3-ol |
| SMILES | CCOOCCc1ccc(-c2c(C)cc(C(CC)(CC)C3(C)C=CC(/C=C/C(O)(CC)CC)=C(C)C3)cc2C)nc1 |
| InChI | InChI=1S/C37H53NO3/c1-10-36(39,11-2)21-18-31-17-20-35(9,25-29(31)8)37(12-3,13-4)32-23-27(6)34(28(7)24-32)33-16-15-30(26-38-33)19-22-41-40-14-5/h15-18,20-21,23-24,26,39H,10-14,19,22,25H2,1-9H3/b21-18+ |
| InChIKey | CLFZQMTWXXBGQY-DYTRJAOYSA-N |
| XLogP | 9.32 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|