About [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol
[(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol (PubChem CID 89289051) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol.
Molecular Properties
| Compound Name | [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol |
| PubChem CID | 89289051 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol |
| SMILES | CCC1C2C=CC(NCO)=CC1C2C |
| InChI | InChI=1S/C12H19NO/c1-3-10-11-5-4-9(13-7-14)6-12(10)8(11)2/h4-6,8,10-14H,3,7H2,1-2H3 |
| InChIKey | XIHLMEDMRBWACL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol?
The IUPAC name of [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol (CID 89289051) is [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol.
What is the SMILES notation for [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol?
The canonical SMILES for [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol is CCC1C2C=CC(NCO)=CC1C2C.
What is the InChIKey of [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol?
The InChIKey is XIHLMEDMRBWACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-10-11-5-4-9(13-7-14)6-12(10)8(11)2/h4-6,8,10-14H,3,7H2,1-2H3.
What are the key properties of [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol?
[(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol has a molecular weight of 193.29 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-ethyl-8-methyl-3-bicyclo[4.1.1]octa-2,4-dienyl)amino]methanol is sourced from PubChem (CID 89289051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).