C18H35N — CID 89289069
(2Z,4Z)-N,7-dimethyl-3-(2-methylpentan-2-yl)deca-2,4-dien-2-amine (PubChem CID 89289069) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is (2Z,4Z)-N,7-dimethyl-3-(2-methylpentan-2-yl)deca-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-N,7-dimethyl-3-(2-methylpentan-2-yl)deca-2,4-dien-2-amine |
|---|---|
| PubChem CID | 89289069 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (2Z,4Z)-N,7-dimethyl-3-(2-methylpentan-2-yl)deca-2,4-dien-2-amine |
| SMILES | CCCC(C)C/C=C\C(=C(/C)NC)C(C)(C)CCC |
| InChI | InChI=1S/C18H35N/c1-8-11-15(3)12-10-13-17(16(4)19-7)18(5,6)14-9-2/h10,13,15,19H,8-9,11-12,14H2,1-7H3/b13-10-,17-16- |
| InChIKey | QMVTXBOLJXWDLD-GULLIVQYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|