C16H14O6 — CID 89289080
2-(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-5-yl)-4-oxobutanoic acid (PubChem CID 89289080) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-5-yl)-4-oxobutanoic acid.
| Compound Name | 2-(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-5-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89289080 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-5-yl)-4-oxobutanoic acid |
| SMILES | O=CCC(C(=O)O)c1cccc2c1CC1C(=O)OC(=O)C1C2 |
| InChI | InChI=1S/C16H14O6/c17-5-4-10(14(18)19)9-3-1-2-8-6-12-13(7-11(8)9)16(21)22-15(12)20/h1-3,5,10,12-13H,4,6-7H2,(H,18,19) |
| InChIKey | DLFHSKRVWBSPFH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|