C11H16F3NO — CID 89289287
3-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]oxyazetidine (PubChem CID 89289287) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]oxyazetidine.
| Compound Name | 3-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]oxyazetidine |
|---|---|
| PubChem CID | 89289287 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]oxyazetidine |
| SMILES | CC/C=C(\C=C(/C)C(F)(F)F)OC1CNC1 |
| InChI | InChI=1S/C11H16F3NO/c1-3-4-9(16-10-6-15-7-10)5-8(2)11(12,13)14/h4-5,10,15H,3,6-7H2,1-2H3/b8-5+,9-4+ |
| InChIKey | DXUJIENCQALKIP-CCMAPKILSA-N |
| XLogP | 2.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|