C20H36O6Si — CID 89289488
[(1R,3R,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propylidene]-6-oxabicyclo[3.2.1]octan-1-yl] acetate (PubChem CID 89289488) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is [(1R,3R,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propylidene]-6-oxabicyclo[3.2.1]octan-1-yl] acetate.
| Compound Name | [(1R,3R,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propylidene]-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
|---|---|
| PubChem CID | 89289488 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | [(1R,3R,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propylidene]-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
| SMILES | COCOCC/C=C1\C2C[C@](OC(C)=O)(CO2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O6Si/c1-15(21)25-20-11-17(24-13-20)16(9-8-10-23-14-22-5)18(12-20)26-27(6,7)19(2,3)4/h9,17-18H,8,10-14H2,1-7H3/b16-9+/t17?,18-,20-/m1/s1 |
| InChIKey | DTRPJMZFFUVPQC-AXDVOEQDSA-N |
| XLogP | 3.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|