C11H15F2N — CID 89289612
(2Z,4E)-3,5-difluoro-6-methyl-N-prop-2-enylhepta-2,4,6-trien-2-amine (PubChem CID 89289612) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is (2Z,4E)-3,5-difluoro-6-methyl-N-prop-2-enylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-3,5-difluoro-6-methyl-N-prop-2-enylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 89289612 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2Z,4E)-3,5-difluoro-6-methyl-N-prop-2-enylhepta-2,4,6-trien-2-amine |
| SMILES | C=CCN/C(C)=C(F)/C=C(/F)C(=C)C |
| InChI | InChI=1S/C11H15F2N/c1-5-6-14-9(4)11(13)7-10(12)8(2)3/h5,7,14H,1-2,6H2,3-4H3/b10-7+,11-9- |
| InChIKey | CXRPROVQLKGICR-BDFJVSTISA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|