C7H17N3O — CID 89289815
(2S)-2-amino-N',3,3-trimethylbutanehydrazide (PubChem CID 89289815) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S)-2-amino-N',3,3-trimethylbutanehydrazide.
| Compound Name | (2S)-2-amino-N',3,3-trimethylbutanehydrazide |
|---|---|
| PubChem CID | 89289815 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (2S)-2-amino-N',3,3-trimethylbutanehydrazide |
| SMILES | CNNC(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C7H17N3O/c1-7(2,3)5(8)6(11)10-9-4/h5,9H,8H2,1-4H3,(H,10,11)/t5-/m1/s1 |
| InChIKey | AKURZRSUNHCLAI-RXMQYKEDSA-N |
| XLogP | -0.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|