C15H25F7O3 — CID 89289919
3-methyl-3-[2-[5,6,6,6-tetrafluoro-2-methyl-5-(trifluoromethyl)hexan-2-yl]oxyethoxy]butan-1-ol (PubChem CID 89289919) has the molecular formula C15H25F7O3 and a molecular weight of 386.35 g/mol. Its IUPAC name is 3-methyl-3-[2-[5,6,6,6-tetrafluoro-2-methyl-5-(trifluoromethyl)hexan-2-yl]oxyethoxy]butan-1-ol.
| Compound Name | 3-methyl-3-[2-[5,6,6,6-tetrafluoro-2-methyl-5-(trifluoromethyl)hexan-2-yl]oxyethoxy]butan-1-ol |
|---|---|
| PubChem CID | 89289919 |
| Molecular Formula | C15H25F7O3 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-methyl-3-[2-[5,6,6,6-tetrafluoro-2-methyl-5-(trifluoromethyl)hexan-2-yl]oxyethoxy]butan-1-ol |
| SMILES | CC(C)(CCO)OCCOC(C)(C)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H25F7O3/c1-11(2,24-9-10-25-12(3,4)7-8-23)5-6-13(16,14(17,18)19)15(20,21)22/h23H,5-10H2,1-4H3 |
| InChIKey | YQBZKSKGPVQSKQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|