C33H63IO6Si2 — CID 89290015
(Z,2S,5S,6R,7S)-1-[(2S,3S,4S,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-9-iodo-6-(methoxymethoxy)-5,7-dimethyldec-8-en-3-yn-2-ol (PubChem CID 89290015) has the molecular formula C33H63IO6Si2 and a molecular weight of 738.94 g/mol. Its IUPAC name is (Z,2S,5S,6R,7S)-1-[(2S,3S,4S,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-9-iodo-6-(methoxymethoxy)-5,7-dimethyldec-8-en-3-yn-2-ol.
| Compound Name | (Z,2S,5S,6R,7S)-1-[(2S,3S,4S,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-9-iodo-6-(methoxymethoxy)-5,7-dimethyldec-8-en-3-yn-2-ol |
|---|---|
| PubChem CID | 89290015 |
| Molecular Formula | C33H63IO6Si2 |
| Molecular Weight | 738.94 g/mol |
| Exact Mass | 738.32 |
| IUPAC Name | (Z,2S,5S,6R,7S)-1-[(2S,3S,4S,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-9-iodo-6-(methoxymethoxy)-5,7-dimethyldec-8-en-3-yn-2-ol |
| SMILES | COCO[C@@H]([C@@H](C)C#C[C@@H](O)C[C@@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C)[C@@H](C)/C=C(/C)I |
| InChI | InChI=1S/C33H63IO6Si2/c1-22(29(37-21-36-12)23(2)19-24(3)34)17-18-27(35)20-28-25(4)30(39-41(13,14)32(6,7)8)26(5)31(38-28)40-42(15,16)33(9,10)11/h19,22-23,25-31,35H,20-21H2,1-16H3/b24-19-/t22-,23-,25-,26+,27+,28-,29-,30-,31+/m0/s1 |
| InChIKey | PYOVIKFJJWYECW-AENVLHBFSA-N |
| XLogP | 8.75 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.94 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|