C21H28BNO4 — CID 89290234
3-cyclohexyl-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-(methylperoxymethyl)-1H-indole (PubChem CID 89290234) has the molecular formula C21H28BNO4 and a molecular weight of 369.27 g/mol. Its IUPAC name is 3-cyclohexyl-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-(methylperoxymethyl)-1H-indole.
| Compound Name | 3-cyclohexyl-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-(methylperoxymethyl)-1H-indole |
|---|---|
| PubChem CID | 89290234 |
| Molecular Formula | C21H28BNO4 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-cyclohexyl-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-(methylperoxymethyl)-1H-indole |
| SMILES | C=C1OB(c2[nH]c3cc(COOC)ccc3c2C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C21H28BNO4/c1-14-21(2,3)27-22(26-14)20-19(16-8-6-5-7-9-16)17-11-10-15(13-25-24-4)12-18(17)23-20/h10-12,16,23H,1,5-9,13H2,2-4H3 |
| InChIKey | PHNCSPMKSZUUCQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|