About 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane
2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane (PubChem CID 89290338) has the molecular formula C15H17F2IO3
and a molecular weight of 410.20 g/mol. Its IUPAC name is 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane |
| PubChem CID | 89290338 |
| Molecular Formula | C15H17F2IO3 |
| Molecular Weight | 410.20 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane |
| SMILES | Fc1ccc(C2CCC(C3OCC(I)CO3)CO2)cc1F |
| InChI | InChI=1S/C15H17F2IO3/c16-12-3-1-9(5-13(12)17)14-4-2-10(6-19-14)15-20-7-11(18)8-21-15/h1,3,5,10-11,14-15H,2,4,6-8H2 |
| InChIKey | HIHLXEPTRRHLLS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane?
The IUPAC name of 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane (CID 89290338) is 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane.
What is the SMILES notation for 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane?
The canonical SMILES for 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane is Fc1ccc(C2CCC(C3OCC(I)CO3)CO2)cc1F.
What is the InChIKey of 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane?
The InChIKey is HIHLXEPTRRHLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2IO3/c16-12-3-1-9(5-13(12)17)14-4-2-10(6-19-14)15-20-7-11(18)8-21-15/h1,3,5,10-11,14-15H,2,4,6-8H2.
What are the key properties of 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane?
2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane has a molecular weight of 410.20 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3,4-difluorophenyl)oxan-3-yl]-5-iodo-1,3-dioxane is sourced from PubChem (CID 89290338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).