About 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile
7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile (PubChem CID 89290782) has the molecular formula C9H8N2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile |
| PubChem CID | 89290782 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile |
| SMILES | Cc1c(C#N)cnc2c1SCC2 |
| InChI | InChI=1S/C9H8N2S/c1-6-7(4-10)5-11-8-2-3-12-9(6)8/h5H,2-3H2,1H3 |
| InChIKey | WTAVCNNLXMFJKP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile?
The IUPAC name of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile (CID 89290782) is 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile.
What is the SMILES notation for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile?
The canonical SMILES for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile is Cc1c(C#N)cnc2c1SCC2.
What is the InChIKey of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile?
The InChIKey is WTAVCNNLXMFJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S/c1-6-7(4-10)5-11-8-2-3-12-9(6)8/h5H,2-3H2,1H3.
What are the key properties of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile?
7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile has a molecular weight of 176.24 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine-6-carbonitrile is sourced from PubChem (CID 89290782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).