C26H31NO6 — CID 89291119
(2S,3S)-2-ethoxy-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-4-[4-(1-methoxyethenyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 89291119) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is (2S,3S)-2-ethoxy-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-4-[4-(1-methoxyethenyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3S)-2-ethoxy-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-4-[4-(1-methoxyethenyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 89291119 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (2S,3S)-2-ethoxy-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-4-[4-(1-methoxyethenyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C=C(OC)c1ccc(C2C=C(C(=O)Nc3ccccc3O)O[C@H](OCC)[C@H]2CCCO)cc1 |
| InChI | InChI=1S/C26H31NO6/c1-4-32-26-20(8-7-15-28)21(19-13-11-18(12-14-19)17(2)31-3)16-24(33-26)25(30)27-22-9-5-6-10-23(22)29/h5-6,9-14,16,20-21,26,28-29H,2,4,7-8,15H2,1,3H3,(H,27,30)/t20-,21?,26-/m0/s1 |
| InChIKey | GLHSQBNGDHJIJQ-ZYOOMIPPSA-N |
| XLogP | 4.40 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|