About 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide
3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 89291164) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| PubChem CID | 89291164 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CCS |
| InChI | InChI=1S/C11H23NOS/c1-10(2,3)8-11(4,5)12-9(13)6-7-14/h14H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | XUBUGRNTZOMTOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The IUPAC name of 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide (CID 89291164) is 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
What is the SMILES notation for 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The canonical SMILES for 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide is CC(C)(C)CC(C)(C)NC(=O)CCS.
What is the InChIKey of 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The InChIKey is XUBUGRNTZOMTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-10(2,3)8-11(4,5)12-9(13)6-7-14/h14H,6-8H2,1-5H3,(H,12,13).
What are the key properties of 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide has a molecular weight of 217.38 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide is sourced from PubChem (CID 89291164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).