About 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine
4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 89291177) has the molecular formula C9H14FNO
and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 89291177 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=CC(OC)=C(F)C(C)C1 |
| InChI | InChI=1S/C9H14FNO/c1-6-4-7(11-2)5-8(12-3)9(6)10/h5-6,11H,4H2,1-3H3 |
| InChIKey | CVQHTQMRRKGSHE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine (CID 89291177) is 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine is CNC1=CC(OC)=C(F)C(C)C1.
What is the InChIKey of 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine?
The InChIKey is CVQHTQMRRKGSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO/c1-6-4-7(11-2)5-8(12-3)9(6)10/h5-6,11H,4H2,1-3H3.
What are the key properties of 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine?
4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine has a molecular weight of 171.22 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methoxy-N,5-dimethylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89291177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).