C22H39N3O5 — CID 89291306
(2R)-2-[[(3R,4R,5S,6R)-4-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]carbamoylamino]-3-methylbutanamide (PubChem CID 89291306) has the molecular formula C22H39N3O5 and a molecular weight of 425.57 g/mol. Its IUPAC name is (2R)-2-[[(3R,4R,5S,6R)-4-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]carbamoylamino]-3-methylbutanamide.
| Compound Name | (2R)-2-[[(3R,4R,5S,6R)-4-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]carbamoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 89291306 |
| Molecular Formula | C22H39N3O5 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (2R)-2-[[(3R,4R,5S,6R)-4-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]carbamoylamino]-3-methylbutanamide |
| SMILES | CO[C@@H]1[C@H](NC(=O)N[C@@H](C(N)=O)C(C)C)CC[C@]2(CO2)[C@H]1[C@@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C22H39N3O5/c1-13(2)8-7-10-21(5,28)18-17(29-6)15(9-11-22(18)12-30-22)24-20(27)25-16(14(3)4)19(23)26/h8,14-18,28H,7,9-12H2,1-6H3,(H2,23,26)(H2,24,25,27)/t15-,16-,17-,18-,21+,22+/m1/s1 |
| InChIKey | KLLHAHRVUFHOIB-YMDUPTGGSA-N |
| XLogP | 1.86 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|