C21H40O2Si — CID 89291388
(E,3S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-3,5-dimethylhept-6-enal (PubChem CID 89291388) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (E,3S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-3,5-dimethylhept-6-enal.
| Compound Name | (E,3S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-3,5-dimethylhept-6-enal |
|---|---|
| PubChem CID | 89291388 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (E,3S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-3,5-dimethylhept-6-enal |
| SMILES | C[C@@H](/C=C/C1CCCCC1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC=O |
| InChI | InChI=1S/C21H40O2Si/c1-17(13-14-19-11-9-8-10-12-19)20(18(2)15-16-22)23-24(6,7)21(3,4)5/h13-14,16-20H,8-12,15H2,1-7H3/b14-13+/t17-,18-,20+/m0/s1 |
| InChIKey | WPGTUGWXKIETBL-VHRLYWSPSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|