About ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate
ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate (PubChem CID 89292140) has the molecular formula C18H23NO6S
and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate |
| PubChem CID | 89292140 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate |
| SMILES | C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1ccc(OCC(=O)OCC)c(C)c1 |
| InChI | InChI=1S/C18H23NO6S/c1-5-13-10-18(13,4)17(21)19-26(22,23)14-7-8-15(12(3)9-14)25-11-16(20)24-6-2/h5,7-9,13H,1,6,10-11H2,2-4H3,(H,19,21)/t13-,18+/m1/s1 |
| InChIKey | ZRUVBZKFWPBVPU-ACJLOTCBSA-N |
| XLogP | 1.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate?
The IUPAC name of ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate (CID 89292140) is ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate.
What is the SMILES notation for ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate?
The canonical SMILES for ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate is C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1ccc(OCC(=O)OCC)c(C)c1.
What is the InChIKey of ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate?
The InChIKey is ZRUVBZKFWPBVPU-ACJLOTCBSA-N. The full InChI is InChI=1S/C18H23NO6S/c1-5-13-10-18(13,4)17(21)19-26(22,23)14-7-8-15(12(3)9-14)25-11-16(20)24-6-2/h5,7-9,13H,1,6,10-11H2,2-4H3,(H,19,21)/t13-,18+/m1/s1.
What are the key properties of ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate?
ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate has a molecular weight of 381.45 g/mol, XLogP of 1.95, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-methylphenoxy]acetate is sourced from PubChem (CID 89292140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).