C20H16ClN3O8S — CID 89292548
2-[[2-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]acetyl]amino]-2-(4-formyl-5-methylidene-2H-1,3-thiazin-2-yl)acetic acid (PubChem CID 89292548) has the molecular formula C20H16ClN3O8S and a molecular weight of 493.88 g/mol. Its IUPAC name is 2-[[2-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]acetyl]amino]-2-(4-formyl-5-methylidene-2H-1,3-thiazin-2-yl)acetic acid.
| Compound Name | 2-[[2-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]acetyl]amino]-2-(4-formyl-5-methylidene-2H-1,3-thiazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 89292548 |
| Molecular Formula | C20H16ClN3O8S |
| Molecular Weight | 493.88 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 2-[[2-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]acetyl]amino]-2-(4-formyl-5-methylidene-2H-1,3-thiazin-2-yl)acetic acid |
| SMILES | C=C1CSC(C(NC(=O)CNC(=O)c2cc3cc(Cl)c(O)cc3oc2=O)C(=O)O)N=C1C=O |
| InChI | InChI=1S/C20H16ClN3O8S/c1-8-7-33-18(23-12(8)6-25)16(19(29)30)24-15(27)5-22-17(28)10-2-9-3-11(21)13(26)4-14(9)32-20(10)31/h2-4,6,16,18,26H,1,5,7H2,(H,22,28)(H,24,27)(H,29,30) |
| InChIKey | WAEQLXBNUHUUGX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.88 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|