C13H11ClFN3O3S — CID 89292808
6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-sulfonyl chloride (PubChem CID 89292808) has the molecular formula C13H11ClFN3O3S and a molecular weight of 343.77 g/mol. Its IUPAC name is 6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-sulfonyl chloride.
| Compound Name | 6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 89292808 |
| Molecular Formula | C13H11ClFN3O3S |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-sulfonyl chloride |
| SMILES | Cc1cc(CNC(=O)c2cc(S(=O)(=O)Cl)ncn2)ccc1F |
| InChI | InChI=1S/C13H11ClFN3O3S/c1-8-4-9(2-3-10(8)15)6-16-13(19)11-5-12(18-7-17-11)22(14,20)21/h2-5,7H,6H2,1H3,(H,16,19) |
| InChIKey | YBIGTLCLKGIVNT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |