C23H48F2N2 — CID 89292933
N-(9,13-difluoro-3,5,7,13-tetramethyltetradecyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 89292933) has the molecular formula C23H48F2N2 and a molecular weight of 390.65 g/mol. Its IUPAC name is N-(9,13-difluoro-3,5,7,13-tetramethyltetradecyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(9,13-difluoro-3,5,7,13-tetramethyltetradecyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89292933 |
| Molecular Formula | C23H48F2N2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.38 |
| IUPAC Name | N-(9,13-difluoro-3,5,7,13-tetramethyltetradecyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(CCNCCCN(C)C)CC(C)CC(C)CC(F)CCCC(C)(C)F |
| InChI | InChI=1S/C23H48F2N2/c1-19(11-14-26-13-9-15-27(6)7)16-20(2)17-21(3)18-22(24)10-8-12-23(4,5)25/h19-22,26H,8-18H2,1-7H3 |
| InChIKey | PVIXHOFHHSNTKB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|